CAS 1347815-20-6
:4-[1,1′-Biphenyl]-4-yl-2-(4-ethylphenyl)thiazole
Description:
4-[1,1′-Biphenyl]-4-yl-2-(4-ethylphenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a biphenyl group, which consists of two phenyl rings connected by a single bond, contributing to its aromatic properties and potential for π-π stacking interactions. The presence of the ethylphenyl substituent enhances its hydrophobic character and may influence its solubility and reactivity. The thiazole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals. This compound may exhibit interesting electronic properties due to the conjugated system formed by the biphenyl and thiazole units, making it a candidate for applications in organic electronics or as a dye. Its specific interactions and stability can be influenced by factors such as temperature, solvent, and pH. Overall, the structural features of this compound suggest potential utility in various chemical and material science applications.
Formula:C23H19NS
InChI:InChI=1S/C23H19NS/c1-2-17-8-10-21(11-9-17)23-24-22(16-25-23)20-14-12-19(13-15-20)18-6-4-3-5-7-18/h3-16H,2H2,1H3
InChI key:InChIKey=QIBLBDKAPULXBO-UHFFFAOYSA-N
SMILES:C(C)C1=CC=C(C2=NC(=CS2)C3=CC=C(C=C3)C4=CC=CC=C4)C=C1
Synonyms:- Thiazole, 4-[1,1′-biphenyl]-4-yl-2-(4-ethylphenyl)-
- 4-[1,1′-Biphenyl]-4-yl-2-(4-ethylphenyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
