CAS 134789-89-2
:2-Thiophenecarbothioamide,3-methyl-(9CI)
Description:
2-Thiophenecarbothioamide, 3-methyl- (CAS 134789-89-2) is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carbothioamide functional group, indicating the presence of a carbonyl group bonded to a sulfur atom and an amine. The methyl group at the 3-position of the thiophene ring contributes to its structural diversity and potentially influences its chemical reactivity and physical properties. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and agricultural applications. The presence of sulfur in the thiophene ring can also impart unique electronic properties, affecting the compound's behavior in various chemical reactions. Additionally, the compound's solubility, melting point, and stability can vary based on its molecular structure and the presence of functional groups, which are essential for understanding its potential applications in synthesis and industry.
Formula:C6H7NS2
InChI:InChI=1S/C6H7NS2/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H2,7,8)
InChI key:InChIKey=OZJWRDXXJWICOF-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=C(C)C=CS1
Synonyms:- 3-Methyl-2-thiophenecarbothioamide
- 2-Thiophenecarbothioamide, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.