CymitQuimica logo

CAS 13479-44-2

:

1,2,3,4-Tetrahydro-2-methyl-2,7-naphthyridine

Description:
1,2,3,4-Tetrahydro-2-methyl-2,7-naphthyridine is a bicyclic organic compound characterized by its fused ring structure, which includes a naphthyridine moiety. This compound features a saturated tetrahydro framework, indicating the presence of four hydrogen atoms added to the naphthyridine structure, resulting in a more stable, saturated form. The presence of a methyl group at the 2-position contributes to its unique chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit solubility in organic solvents, which is common for similar nitrogen-containing heterocycles. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-11-5-3-8-2-4-10-6-9(8)7-11/h2,4,6H,3,5,7H2,1H3
InChI key:InChIKey=VUEIFZAGWOPJEY-UHFFFAOYSA-N
SMILES:CN1CC=2C(CC1)=CC=NC2
Synonyms:
  • 2-Methyl-1,2,3,4-tetrahydro-[2,7]naphthyridine
  • 2-Methyl-1,2,3,4-tetrahydro-2,7-naphthyridine
  • 1,2,3,4-Tetrahydro-2-methyl-2,7-naphthyridine
  • 2,7-Naphthyridine, 1,2,3,4-tetrahydro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.