CAS 13479-88-4

5,7-dichlorothiazolo[5,4-d]pyrimidine

Description:

5,7-Dichlorothiazolo[5,4-d]pyrimidine is a heterocyclic compound characterized by a fused thiazole and pyrimidine ring system, which incorporates two chlorine substituents at the 5 and 7 positions of the thiazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of chlorine atoms can influence its reactivity and solubility, making it a subject of interest in various chemical reactions and applications. Additionally, the thiazolo and pyrimidine moieties contribute to its electronic properties, which can affect its interaction with biological targets. As with many heterocycles, it may exhibit fluorescence or other photophysical properties, depending on its environment. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅HCl₂N₃S

InChI: InChI=1/C5HCl2N3S/c6-3-2-4(11-1-8-2)10-5(7)9-3/h1H

SMILES: c1nc2c(Cl)nc(Cl)nc2s1

Synonyms:

• 5,7-Dichloro[1,3]thiazolo[5,4-d]pyrimidine
• Thiazolo[5,4-d]pyrimidine, 5,7-dichloro-
• 5,7-dichlorothiazolo[5,4-d]pyrimidine

5,7-Dichlorothiazolo[5,4-d]pyrimidine

CAS: 13479-88-4

Formula: C₅HCl₂N₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.0525

Ref: IN-DA007LRE

5,7-Dichlorothiazolo[5,4-d]pyrimidine

CAS: 13479-88-4

5,7-Dichlorothiazolo[5,4-d]pyrimidine

Purity: 99%

Molecular weight: 206.05g/mol

Ref: 54-OR72236

5,7-Dichlorothiazolo[5,4-d]pyrimidine

CAS: 13479-88-4

Formula: C₅HCl₂N₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.04

Ref: 10-F092360