CymitQuimica logo

CAS 134796-35-3

:

5-[[(2-Chloro-5-thiazolyl)methyl]thio]-1H-1,2,4-triazole

Description:
5-[[(2-Chloro-5-thiazolyl)methyl]thio]-1H-1,2,4-triazole is a chemical compound characterized by its unique structural features, which include a triazole ring and a thiazole moiety. The presence of a chlorine atom on the thiazole ring contributes to its reactivity and potential biological activity. This compound is often studied for its fungicidal properties and may be utilized in agricultural applications to control fungal diseases in crops. Its thioether linkage enhances its stability and solubility in various solvents, making it suitable for formulation in different environments. The compound's molecular structure allows for interactions with biological targets, which can lead to significant pharmacological effects. Additionally, its synthesis typically involves multi-step organic reactions, highlighting its complexity. As with many chemical substances, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, 5-[[(2-Chloro-5-thiazolyl)methyl]thio]-1H-1,2,4-triazole represents a class of compounds with important applications in both chemistry and agriculture.
Formula:C6H5ClN4S2
InChI:InChI=1S/C6H5ClN4S2/c7-5-8-1-4(13-5)2-12-6-9-3-10-11-6/h1,3H,2H2,(H,9,10,11)
InChI key:InChIKey=DGJCDHZQSZQKPP-UHFFFAOYSA-N
SMILES:C(SC=1NC=NN1)C2=CN=C(Cl)S2
Synonyms:
  • 1H-1,2,4-Triazole, 5-[[(2-chloro-5-thiazolyl)methyl]thio]-
  • 1H-1,2,4-Triazole, 3-[[(2-chloro-5-thiazolyl)methyl]thio]-
  • 5-[[(2-Chloro-5-thiazolyl)methyl]thio]-1H-1,2,4-triazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.