CymitQuimica logo

CAS 13480-40-5

:

6,7-DIHYDROPYRAZINO[2,3-D]PYRIDAZINE-5,8-DIONE

Description:
6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione, with the CAS number 13480-40-5, is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both pyrazine and pyridazine moieties. This compound features a fused ring system, which contributes to its potential biological activity and chemical reactivity. It typically exhibits a range of functional groups, including carbonyls, which can participate in various chemical reactions. The presence of nitrogen atoms in the ring structure often imparts basic properties, allowing for interactions with other molecules. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial or antitumor activities. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, 6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione represents a class of compounds that could be valuable in research and development within the fields of organic and medicinal chemistry.
Formula:C6H4N4O2
InChI:InChI=1/C6H4N4O2/c11-5-3-4(6(12)10-9-5)8-2-1-7-3/h1-2H,(H,9,11)(H,10,12)
InChI key:MODLYLCAANSASD-UHFFFAOYSA-N
SMILES:c1cnc2c(c(nnc2O)O)n1
Synonyms:
  • Pyrazino[2,3-D]Pyridazine-5,8-Dione, 6,7-Dihydro-
  • 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione
  • 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione (Impurity)
Found 5 products.