CAS 13481-25-9

2,3-pyrazinedicarbonitrile

Description:

2,3-Pyrazinedicarbonitrile is an organic compound characterized by its pyrazine ring structure, which features two cyano (nitrile) groups attached to the 2 and 3 positions of the ring. This compound is typically a solid at room temperature and is known for its high melting point and low solubility in water, reflecting its polar nature due to the presence of the cyano groups. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of multiple cyano groups contributes to its reactivity, making it a valuable building block in the synthesis of more complex molecules. Additionally, 2,3-pyrazinedicarbonitrile may exhibit interesting electronic properties due to the conjugation within the pyrazine ring, which can influence its behavior in chemical reactions and interactions with other substances. Safety data should be consulted, as compounds with cyano groups can be toxic and require careful handling.

Formula: C₆H₂N₄

InChI: InChI=1/C6H2N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2H

SMILES: c1cnc(C#N)c(C#N)n1

Pyrazine-2,3-Dicarbonitrile

CAS: 13481-25-9

Formula: C₆H₂N₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 130.1069

Ref: IN-DA003U1T

2,3-Dicyanopyrazine

CAS: 13481-25-9

2,3-Dicyanopyrazine

Purity: 99%

Molecular weight: 130.11g/mol

Ref: 54-OR923278

2,3-Dicyanopyrazine

CAS: 13481-25-9

Formula: C₆H₂N₄

Purity: >99.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 130.11

Ref: 3B-D1751

Pyrazine-2,3-dicarbonitrile

CAS: 13481-25-9

Formula: C₆H₂N₄

Purity: 95%

Color and Shape: Solid, Chunks or Crystalline Powder

Molecular weight: 130.11

Ref: 10-F222380