CAS 13481-26-0

Pyrazino[2,3-d]pyridazine-5,8-diamine

Description:

Pyrazino[2,3-d]pyridazine-5,8-diamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrazine ring fused to a pyridazine ring. This compound features two amino groups (-NH2) located at the 5 and 8 positions of the pyridazine moiety, contributing to its potential reactivity and biological activity. It is typically a crystalline solid, and its solubility can vary depending on the solvent used. The presence of the amino groups allows for hydrogen bonding, which can influence its interactions in biological systems. Pyrazino[2,3-d]pyridazine-5,8-diamine has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antitumor and antimicrobial activities. Its chemical behavior can be influenced by factors such as pH and the presence of other functional groups, making it a subject of study in drug development and synthesis. As with many heterocycles, its reactivity and stability are key considerations in its applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₆H₆N₆

InChI: InChI=1S/C6H6N6/c7-5-3-4(6(8)12-11-5)10-2-1-9-3/h1-2H,(H2,7,11)(H2,8,12)

InChI key: InChIKey=WJOWNFIKZLTSFS-UHFFFAOYSA-N

SMILES: NC=1C2=C(C(N)=NN1)N=CC=N2

Synonyms:

• Pyrazino[2,3-d]pyridazine-5,8-diamine
• Pyrazino[2,3-d]pyridazine, 5,8-diamino-