CAS 13481-62-4
:2-(3-TRIFLUOROMETHYL-PHENYLAMINO)-BENZONITRILE
Description:
2-(3-Trifluoromethyl-phenylamino)-benzonitrile, with the CAS number 13481-62-4, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and a trifluoromethyl-substituted phenylamino group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Additionally, the nitrile functional group contributes to its polar character, which can affect solubility in various solvents. This compound may be of interest in pharmaceutical and agrochemical research due to its potential biological activity and utility as a building block in synthetic chemistry. Its specific applications and behavior would depend on further studies, including its reactivity, stability under different conditions, and interactions with other chemical entities.
Formula:C14H9F3N2
InChI:InChI=1/C14H9F3N2/c15-14(16,17)11-5-3-6-12(8-11)19-13-7-2-1-4-10(13)9-18/h1-8,19H
SMILES:c1ccc(c(c1)C#N)Nc1cccc(c1)C(F)(F)F
Synonyms:- 2-{[3-(Trifluoromethyl)phenyl]amino}benzonitrile
- Benzonitrile, 2-[[3-(Trifluoromethyl)Phenyl]Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
