CAS 13481-63-5

2-(2H-Tetrazol-5-yl)-N-[3-(trifluoromethyl)phenyl]benzenamine

Description:

2-(2H-Tetrazol-5-yl)-N-[3-(trifluoromethyl)phenyl]benzenamine, with CAS number 13481-63-5, is a chemical compound characterized by its complex structure, which includes a tetrazole ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic amines and heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine and tetrazole functionalities. The trifluoromethyl group often imparts unique electronic properties, enhancing lipophilicity and influencing biological activity. Additionally, tetrazole derivatives are known for their applications in pharmaceuticals, particularly as bioisosteres for carboxylic acids, due to their ability to mimic certain functional groups while providing improved metabolic stability. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, its structural features suggest potential utility in various chemical and biological applications, although specific reactivity and stability would depend on the surrounding conditions.

Formula: C₁₄H₁₀F₃N₅

InChI: InChI=1S/C14H10F3N5/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13-19-21-22-20-13/h1-8,18H,(H,19,20,21,22)

InChI key: InChIKey=JPEXITLSZOMSFC-UHFFFAOYSA-N

SMILES: N(C1=C(C=CC=C1)C=2NN=NN2)C3=CC(C(F)(F)F)=CC=C3

Synonyms:

• Benzenamine, 2-(2H-tetrazol-5-yl)-N-[3-(trifluoromethyl)phenyl]-
• 2-(5-Tetrazolyl)-N-(3-trifluoromethylphenyl)aniline
• 2-(2H-Tetrazol-5-yl)-N-[3-(trifluoromethyl)phenyl]benzenamine
• 1H-Tetrazole, 5-[o-(α,α,α-trifluoro-m-toluidino)phenyl]-
• Benzenamine, 2-(1H-tetrazol-5-yl)-N-[3-(trifluoromethyl)phenyl]-

SKF32802

CAS: 13481-63-5

SKF32802 is a novel potent, selective hERG potassium channel (Kv11.1) activator that induces a leftward shift in the voltage dependence of activation.

Formula: C₁₄H₁₀F₃N₅

Color and Shape: Solid

Molecular weight: 305.26

Ref: TM-T70922