
CAS 13481-87-3
:Methyl 3-nonenoate
Description:
Methyl 3-nonenoate is an organic compound classified as an ester, specifically derived from nonenoic acid and methanol. It features a nonene backbone with a double bond located at the third carbon position, contributing to its unsaturated nature. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it of interest in flavor and fragrance applications. Methyl 3-nonenoate has a moderate boiling point and is soluble in organic solvents, while being less soluble in water due to its hydrophobic characteristics. Its molecular structure includes a methyl group attached to the carboxylate end, which influences its reactivity and interactions with other chemical species. As an unsaturated ester, it can participate in various chemical reactions, including polymerization and addition reactions, making it valuable in synthetic organic chemistry. Safety data indicates that, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-3-4-5-6-7-8-9-10(11)12-2/h7-8H,3-6,9H2,1-2H3
InChI key:InChIKey=MTDCXFZGUVZRSQ-UHFFFAOYSA-N
SMILES:C(=CCC(OC)=O)CCCCC
Synonyms:- Methyl 3-nonenoate
- 3-Nonenoic acid, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
