CAS 134811-95-3
:3-(4-Phenyl-2-thiazolyl)benzenamine
Description:
3-(4-Phenyl-2-thiazolyl)benzenamine, identified by its CAS number 134811-95-3, is an organic compound characterized by its aromatic structure, which includes a thiazole ring and an aniline moiety. This compound features a phenyl group attached to a thiazole ring at one position and an amino group at the meta position relative to the thiazole. The presence of the thiazole ring imparts unique electronic properties, making it potentially useful in various applications, including pharmaceuticals and materials science. The compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 3-(4-Phenyl-2-thiazolyl)benzenamine represents a class of compounds that can be explored for diverse chemical and biological applications.
Formula:C15H12N2S
InChI:InChI=1S/C15H12N2S/c16-13-8-4-7-12(9-13)15-17-14(10-18-15)11-5-2-1-3-6-11/h1-10H,16H2
InChI key:InChIKey=PPBSCESYWWRRAX-UHFFFAOYSA-N
SMILES:NC=1C=C(C2=NC(=CS2)C3=CC=CC=C3)C=CC1
Synonyms:- Benzenamine, 3-(4-phenyl-2-thiazolyl)-
- 3-(4-Phenyl-2-thiazolyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.