CAS 134812-31-0
:3-[2-(4-Pyridinyl)-4-thiazolyl]benzenamine
Description:
3-[2-(4-Pyridinyl)-4-thiazolyl]benzenamine, with the CAS number 134812-31-0, is an organic compound characterized by its complex structure that includes a benzene ring, a pyridine moiety, and a thiazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the pyridine and thiazole rings suggests that it may interact with biological targets, potentially influencing various biochemical pathways. Its molecular structure allows for hydrogen bonding and π-π stacking interactions, which can be significant in drug design and development. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it suitable for further chemical modifications. Overall, 3-[2-(4-Pyridinyl)-4-thiazolyl]benzenamine represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of oncology or infectious diseases, depending on its biological profile.
Formula:C14H11N3S
InChI:InChI=1S/C14H11N3S/c15-12-3-1-2-11(8-12)13-9-18-14(17-13)10-4-6-16-7-5-10/h1-9H,15H2
InChI key:InChIKey=JCYDARGRFLNTFS-UHFFFAOYSA-N
SMILES:NC=1C=C(C=2N=C(SC2)C=3C=CN=CC3)C=CC1
Synonyms:- 3-[2-(4-Pyridinyl)-4-thiazolyl]benzenamine
- Benzenamine, 3-[2-(4-pyridinyl)-4-thiazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.