CAS 134815-78-4: 1,1'-[BIPHENYL-4,4'-DIYLBIS(METHYLENE)]BIS(4,4'-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE)
Description:1,1'-[BIPHENYL-4,4'-DIYLBIS(METHYLENE)]BIS(4,4'-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE), with CAS number 134815-78-4, is a complex organic compound characterized by its bipyridinium structure, which contributes to its unique electrochemical properties. This substance features a biphenyl backbone with methylene linkers, enhancing its stability and solubility in various solvents. The presence of hexafluorophosphate anions indicates strong ionic interactions, making it a suitable candidate for applications in ionic liquids and electrochemical systems. Its structure allows for potential use in molecular electronics and as a redox-active material. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as temperature and solvent choice. Additionally, it may exhibit interesting photophysical properties, making it relevant in the fields of materials science and photochemistry. Safety data should be consulted for handling, as the presence of fluorinated groups can pose specific hazards. Overall, this compound represents a fascinating area of study within organic and materials chemistry.
InChI:InChI=1/C34H28N4.2F6P/c1-5-29(6-2-27(1)25-37-21-13-33(14-22-37)31-9-17-35-18-10-31)30-7-3-28(4-8-30)26-38-23-15-34(16-24-38)32-11-19-36-20-12-32;2*1-7(2,3,4,5)6/h1-24H,25-26H2;;/q+2;2*-1
- Synonyms:
- 1,1'-[Biphenyl-4,4'-diylbis(methylene)]bis[4-(pyridin-4-yl)pyridinium] dihexafluorophosphate
- 1,1'-(Biphenyl-4,4'-Diyldimethanediyl)Bis(4-Pyridin-4-Ylpyridinium) Dihexafluorophosphate

1,1-[BIPHENYL-4,4-DIYLBIS(METHYLENE)]BIS(4,4-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE)
Ref: IN-DA003D6T
Undefined size | To inquire |

1,1?-[Biphenyl-4,4?-Diylbis(Methylene)]Bis(4,4?-Bipyridinium) Bis(Hexafluorophosphate)
Ref: 54-PC105037
1g | 1,054.00 € | ||
100mg | 213.00 € | ||
250mg | 290.00 € |

1,1'-[Biphenyl-4,4'-diylbis(methylene)]bis(4,4'-bipyridinium) Bis(hexafluorophosphate)
Ref: 3B-B2280
100mg | 180.00 € |

1,1'-[4,4'-Biphenyldiylbis(Methylene)]Bis[4-(4-Pyridinyl)Pyridinium] Dihexafluorophosphate
Ref: 3D-FB101717
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |