CAS 134818-67-0
:2-Chloro-α-(1-chlorocyclopropyl)-α-(chloromethyl)benzeneethanol
Description:
2-Chloro-α-(1-chlorocyclopropyl)-α-(chloromethyl)benzeneethanol, with the CAS number 134818-67-0, is a chemical compound characterized by its complex structure, which includes multiple chlorine substituents and a cyclopropyl group. This compound is likely to exhibit properties typical of chlorinated organic compounds, such as increased lipophilicity and potential reactivity due to the presence of multiple halogen atoms. The presence of the alcohol functional group suggests that it may engage in hydrogen bonding, influencing its solubility and boiling point. Additionally, the chlorinated groups may impart unique biological activity, making it of interest in pharmaceutical or agrochemical research. Its synthesis and reactivity would be influenced by the steric and electronic effects of the substituents, which could affect its stability and interactions with other chemical species. Overall, this compound's characteristics make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C12H13Cl3O
InChI:InChI=1S/C12H13Cl3O/c13-8-12(16,11(15)5-6-11)7-9-3-1-2-4-10(9)14/h1-4,16H,5-8H2
InChI key:InChIKey=LGNKJFHEXZRYDM-UHFFFAOYSA-N
SMILES:C(CC1=C(Cl)C=CC=C1)(CCl)(O)C2(Cl)CC2
Synonyms:- 1-Chloro-2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)propan-2-ol
- 2-Chloro-α-(1-chlorocyclopropyl)-α-(chloromethyl)benzeneethanol
- Benzeneethanol, 2-chloro-α-(1-chlorocyclopropyl)-α-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
