CymitQuimica logo

CAS 134818-68-1

:

2-(1-Chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane

Description:
2-(1-Chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane, with the CAS number 134818-68-1, is a synthetic organic compound characterized by its unique oxirane (epoxide) structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chlorocyclopropyl group and a chlorophenyl group enhances its chemical properties, including increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its reactivity as an epoxide allows for various nucleophilic substitution reactions, which can be exploited in the synthesis of more complex molecules. Additionally, the chlorinated substituents may influence its interaction with biological targets, potentially leading to applications in agrochemicals or pharmaceuticals. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can impart toxicity and environmental concerns. Overall, this compound represents a valuable structure for exploration in chemical research and development.
Formula:C12H12Cl2O
InChI:InChI=1S/C12H12Cl2O/c13-10-4-2-1-3-9(10)7-12(8-15-12)11(14)5-6-11/h1-4H,5-8H2
InChI key:InChIKey=IKKKLHQSHUAIMM-UHFFFAOYSA-N
SMILES:C(C1(CO1)C2(Cl)CC2)C3=C(Cl)C=CC=C3
Synonyms:
  • 2-(1-Chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane
  • Oxirane, 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]-
  • Oξrane, 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]-
  • T3Otj B1R Bg& B- Al3Tj Ag
  • 2-(1-Chlorocycloprop-1-yl)-2-(2-chlorobenzyl)oxirane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.