CAS 13482-24-1
:Cyclohexanone-3,3,5,5-d4, 4-hydroxy-
Description:
Cyclohexanone-3,3,5,5-d4, 4-hydroxy- is a deuterated derivative of cyclohexanone, which is a cyclic ketone with a six-membered carbon ring. The presence of deuterium atoms (d4) indicates that four hydrogen atoms in the cyclohexanone structure have been replaced with deuterium, a stable isotope of hydrogen. This modification can be useful in various applications, particularly in NMR spectroscopy, where deuterated solvents are employed to reduce background signals. The hydroxyl group (-OH) at the 4-position contributes to its reactivity and solubility in polar solvents. Cyclohexanone itself is a colorless liquid with a distinctive odor, and the presence of the hydroxyl group may enhance its hydrogen bonding capabilities. This compound is typically used in organic synthesis, as a solvent, and in the production of various chemicals. Its unique isotopic labeling allows for tracking and studying reaction mechanisms and pathways in chemical research.
Formula:C6H6D4O2
InChI:InChI=1S/C6H10O2/c7-5-1-2-6(8)4-3-5/h5,7H,1-4H2/i1D2,3D2
InChI key:InChIKey=BXBJZYXQHHPVGO-VEPVEJTGSA-N
SMILES:OC1C(CC(=O)CC1([2H])[2H])([2H])[2H]
Synonyms:- Cyclohexanone-3,3,5,5-d4, 4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
