CAS 134821-22-0

(4-Methoxyphenyl)(2-thioxo-3-thiazolidinyl)methanone

Description:

(4-Methoxyphenyl)(2-thioxo-3-thiazolidinyl)methanone, with the CAS number 134821-22-0, is a chemical compound that features a thiazolidinone core, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a methoxy group attached to a phenyl ring, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The thiazolidinone structure is known for its biological activity, often exhibiting properties such as antimicrobial, anti-inflammatory, and antidiabetic effects. The thioxo group in the thiazolidinone framework may enhance its reactivity, making it a candidate for various chemical transformations. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry and drug development, particularly in the synthesis of novel therapeutic agents. Its unique combination of functional groups and structural features makes it an interesting subject for further research in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₁NO₂S₂

InChI: InChI=1S/C11H11NO2S2/c1-14-9-4-2-8(3-5-9)10(13)12-6-7-16-11(12)15/h2-5H,6-7H2,1H3

InChI key: InChIKey=PRVIBPPECORITJ-UHFFFAOYSA-N

SMILES: C(=O)(N1C(=S)SCC1)C2=CC=C(OC)C=C2

Synonyms:

• (4-Methoxyphenyl)(2-thioxo-3-thiazolidinyl)methanone
• 2-Thiazolidinethione, 3-(4-methoxybenzoyl)-
• Methanone, (4-methoxyphenyl)(2-thioxo-3-thiazolidinyl)-
• (4-Methoxyphenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone