CymitQuimica logo

CAS 134833-83-3

:

Acetamide, 2-bromo-N-methoxy-N-methyl-

Description:
Acetamide, 2-bromo-N-methoxy-N-methyl- is an organic compound characterized by its amide functional group, which features a carbonyl group (C=O) directly bonded to a nitrogen atom (N). This compound contains a bromine atom at the second position of the acetamide structure, which can influence its reactivity and physical properties. The presence of both methoxy (–OCH3) and methyl (–CH3) groups attached to the nitrogen atom contributes to its overall molecular structure and can affect its solubility and polarity. Typically, compounds like this may exhibit moderate to high solubility in polar solvents due to the presence of the methoxy group. The bromine substituent can also introduce unique reactivity patterns, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization. Safety data and handling precautions should be consulted due to the presence of bromine and the potential biological activity of the compound.
Formula:C4H8BrNO2
InChI:InChI=1S/C4H8BrNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3
InChI key:GKJMVMJIDBDPDZ-UHFFFAOYSA-N
SMILES:CN(C(=O)CBr)OC
Found 6 products.