CAS 13484-51-0: 3,5,6-Trichloro-2-pyrazinamine
Description:3,5,6-Trichloro-2-pyrazinamine is a chemical compound characterized by its pyrazinamine structure, which features a pyrazine ring substituted with three chlorine atoms and an amino group. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including agrochemicals and pharmaceuticals. The presence of chlorine atoms contributes to its reactivity and may influence its biological activity. As a chlorinated derivative, it may exhibit properties such as increased lipophilicity and stability, which can affect its behavior in biological systems. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Safety data sheets indicate that handling this compound requires caution due to its potential toxicity and environmental impact. Overall, 3,5,6-Trichloro-2-pyrazinamine is a compound of interest for research and development, particularly in the context of its chemical properties and potential applications.
Formula:C4H2Cl3N3
InChI:InChI=1S/C4H2Cl3N3/c5-1-2(6)10-4(8)3(7)9-1/h(H2,8,10)
InChI key:InChIKey=NRDPLJROSGVEDO-UHFFFAOYSA-N
SMILES:ClC=1N=C(Cl)C(=NC1Cl)N
- Synonyms:
- 2-Amino-3,5,6-trichloropyrazine
- Pyrazinamine, 3,5,6-trichloro-
- Pyrazine, aminotrichloro-
- 3,5,6-Trichloro-2-pyrazinamine
- 2-Pyrazinamine, 3,5,6-trichloro-

Ref: IN-DA009HMA
1g | 324.00 € | ||
5g | To inquire | ||
100mg | 102.00 € | ||
250mg | 153.00 € |

Ref: 54-OR77022
1g | 567.00 € | ||
5g | 1,648.00 € | ||
250mg | 209.00 € |

Ref: 10-F529895
1g | 267.00 € | ||
5g | 810.00 € | ||
100mg | 89.00 € | ||
250mg | 100.00 € |

Trichloropyrazin-2-amine
Ref: 3D-NAA48451
1g | 843.00 € | ||
100mg | 394.00 € |