CAS 13484-95-2
:6-Amino-5-hydroxy-2(1H)-pyrimidinone
Description:
6-Amino-5-hydroxy-2(1H)-pyrimidinone, with the CAS number 13484-95-2, is an organic compound that belongs to the class of pyrimidinones, which are characterized by a six-membered aromatic ring containing nitrogen atoms. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the pyrimidine ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds with hydroxyl groups. The presence of both amino and hydroxyl functional groups suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound is of interest in medicinal chemistry and biochemistry, particularly in the context of nucleic acid metabolism and as a potential precursor in the synthesis of various pharmaceuticals. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature.
Formula:C4H5N3O2
InChI:InChI=1S/C4H5N3O2/c5-3-2(8)1-6-4(9)7-3/h1,8H,(H3,5,6,7,9)
InChI key:InChIKey=NLLCDONDZDHLCI-UHFFFAOYSA-N
SMILES:NC1=C(O)C=NC(=O)N1
Synonyms:- 2(1H)-Pyrimidinone, 4-amino-5-hydroxy-
- 2(1H)-Pyrimidinone, 6-amino-5-hydroxy-
- 4-Amino-5-hydroxy-2(1H)-pyrimidinone
- 5-Hydroxycytosine
- 6-Amino-5-hydroxy-2(1H)-pyrimidinone
- 6-amino-5-hydroxypyrimidin-2(1H)-one
- Cytosine, 5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-Hydroxycytosine
CAS:Controlled ProductApplications 5-Hydroxycytosine, is been identified as an anomalous base of phage H-17 DNA. It is also a monosubstituted cytosine, as nucleotide-base antimetabolite-type potential anticarcinogen.
References Khromov, I. S. Doklady Akademii Nauk SSSR, 240, 1486 (1978); Ladik, J., et al.: Magyar Kemiai Folyoirat, 76, 589 (1970);Formula:C4H5N3O2Color and Shape:NeatMolecular weight:127.1


