CAS 134850-51-4

N-[2-(2-Amino-1H-imidazol-4-yl)ethyl]-4-(3-aminopropoxy)-3,5-dibromo-α-(hydroxyimino)benzenepropanamide

Description:

N-[2-(2-Amino-1H-imidazol-4-yl)ethyl]-4-(3-aminopropoxy)-3,5-dibromo-α-(hydroxyimino)benzenepropanamide, with CAS number 134850-51-4, is a complex organic compound characterized by its multi-functional structure. It features an imidazole ring, which is known for its role in biological systems, particularly in enzyme activity and as a building block for various biomolecules. The presence of bromine atoms indicates potential reactivity and the ability to participate in electrophilic substitution reactions. The hydroxylamine functional group suggests that this compound may exhibit properties related to redox reactions and can act as a nucleophile. Additionally, the amine groups contribute to its basicity and potential for hydrogen bonding, which can influence solubility and interaction with biological targets. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₇H₂₂Br₂N₆O₃

InChI: InChI=1S/C17H22Br2N6O3/c18-12-6-10(7-13(19)15(12)28-5-1-3-20)8-14(25-27)16(26)22-4-2-11-9-23-17(21)24-11/h6-7,9,27H,1-5,8,20H2,(H,22,26)(H3,21,23,24)

InChI key: InChIKey=VZDKEGKTDBWXJY-UHFFFAOYSA-N

SMILES: C(C(C(NCCC1=CN=C(N)N1)=O)=NO)C2=CC(Br)=C(OCCCN)C(Br)=C2

Synonyms:

• (2E)-N-[2-(2-amino-1H-imidazol-5-yl)ethyl]-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-(hydroxyimino)propanamide
• Benzenepropanamide, N-(2-(2-amino-1H-imidazol-4-yl)ethyl)-4-(3-aminopropoxy)-3,5-dibromo-alpha-(hydroxyimino)-
• Benzenepropanamide, N-[2-(2-amino-1H-imidazol-4-yl)ethyl]-4-(3-aminopropoxy)-3,5-dibromo-α-(hydroxyimino)-
• N-[2-(2-Amino-1H-imidazol-4-yl)ethyl]-4-(3-aminopropoxy)-3,5-dibromo-α-(hydroxyimino)benzenepropanamide
• Purealidine A
• Purealidin A

Purealidin A

Controlled Product

CAS: 134850-51-4

Formula: C₁₇H₂₂Br₂N₆O₃

Color and Shape: Neat

Molecular weight: 518.203

Ref: TR-P678820

Purealidin A

CAS: 134850-51-4

Purealidin A is a natural antibiotic, which is extracted from certain medicinal plants. This compound is primarily derived from the fermentation of specific plant species known for their antimicrobial properties. Its mode of action involves the inhibition of bacterial cell wall synthesis, which consequently disrupts the integrity and reproduction of bacterial cells, leading to cell lysis and death.

Formula: C₁₇H₂₂Br₂N₆O₃

Purity: Min. 95%

Molecular weight: 518.2 g/mol

Ref: 3D-JFA85051