
CAS 134855-95-1
:4-[(1R)-1-Aminoethyl]-2-methoxyphenol
Description:
4-[(1R)-1-Aminoethyl]-2-methoxyphenol, also known by its CAS number 134855-95-1, is an organic compound characterized by its phenolic structure, which includes a methoxy group and an aminoethyl substituent. This compound features a chiral center, indicated by the (1R) configuration, which can influence its biological activity and interactions. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. As a phenol derivative, it may exhibit antioxidant properties and could be involved in various biochemical pathways. The aminoethyl group suggests potential for interactions with biological receptors or enzymes, making it of interest in medicinal chemistry. Its specific applications may vary, but compounds of this nature are often explored for their pharmacological properties, including potential roles in neurochemistry or as precursors in synthetic pathways. Overall, the compound's unique structural features contribute to its chemical reactivity and potential utility in various scientific fields.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-6,11H,10H2,1-2H3/t6-/m1/s1
InChI key:InChIKey=CCUOPHCFZGJEKT-ZCFIWIBFSA-N
SMILES:O(C)C1=CC([C@@H](C)N)=CC=C1O
Synonyms:- (R)-4-(1-Aminoethyl)-2-methoxyphenol
- 4-[(1R)-1-Aminoethyl]-2-methoxyphenol
- Phenol, 4-[(1R)-1-aminoethyl]-2-methoxy-
- Phenol, 4-(1-aminoethyl)-2-methoxy-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.