CAS 134856-03-4

1,2-Benzenediol, 4-(1-aminoethyl)-, (R)-

Description:

1,2-Benzenediol, 4-(1-aminoethyl)-, (R)-, also known as (R)-4-(1-aminoethyl)-1,2-benzenediol, is an organic compound characterized by its aromatic structure featuring a benzene ring with two hydroxyl groups (diol) and an aminoethyl side chain. The presence of the hydroxyl groups contributes to its potential as a phenolic compound, which can exhibit antioxidant properties. The (R)- designation indicates that the compound has a specific stereochemistry, which can influence its biological activity and interactions. This compound may be involved in various chemical reactions, including those typical of amines and phenols, such as nucleophilic substitutions and hydrogen bonding. Its applications could span fields such as pharmaceuticals, where it may serve as an intermediate or active ingredient, and materials science, where its properties might be harnessed in polymer synthesis or as a stabilizer. As with many organic compounds, its solubility, reactivity, and stability can be influenced by environmental conditions such as pH and temperature.

Formula: C₈H₁₁NO₂

InChI: InChI=1S/C8H11NO2/c1-5(9)6-2-3-7(10)8(11)4-6/h2-5,10-11H,9H2,1H3/t5-/m1/s1

InChI key: InChIKey=HLADORYGYPYJHO-RXMQYKEDSA-N

SMILES: [C@H](C)(N)C1=CC(O)=C(O)C=C1

Synonyms:

• 1,2-Benzenediol, 4-(1-aminoethyl)-, (R)-
• 1,2-Benzenediol 4-(1-aminoethyl)-, (R)-