CAS 134865-70-6
:8-M-PDOT
Description:
8-M-PDOT, or 8-Methyl-1,3-dihydro-2H-pyrrolo[3,4-b]quinolin-1-one, is a chemical compound characterized by its unique structure that includes a pyrroloquinoline framework. This compound is known for its potential applications in various fields, including medicinal chemistry and materials science. It typically exhibits properties such as moderate solubility in organic solvents and may demonstrate biological activity, which makes it of interest in pharmacological research. The presence of the methyl group at the 8-position can influence its reactivity and interaction with biological targets. Additionally, 8-M-PDOT may undergo various chemical reactions, including oxidation and substitution, depending on the conditions. Its specific characteristics, such as melting point, boiling point, and spectral data, are essential for identifying and utilizing the compound in research and industrial applications. As with many chemical substances, safety data sheets should be consulted to understand its handling, storage, and potential hazards.
Formula:C14H19NO2
InChI:InChI=1/C14H19NO2/c1-3-14(16)15-11-8-7-10-5-4-6-13(17-2)12(10)9-11/h4-6,11H,3,7-9H2,1-2H3,(H,15,16)
SMILES:CCC(=NC1CCc2cccc(c2C1)OC)O
Synonyms:- 8-Methoxy-2-Propionamidotetralin
- N-(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
AH 002
CAS:Controlled ProductAH 002 is a proapoptotic drug that has been shown to induce apoptosis in several cancer cell lines, including cervical cancer. AH 002 binds to the mitochondrial receptors MT2 and prevents the release of cytochrome C from the mitochondria into the cytosol. This causes a decrease in mitochondrial membrane potential and an increase in reactive oxygen species (ROS), leading to cell death by apoptosis. AH 002 has also been shown to be effective against animal models of neurodegenerative disease, such as Parkinson's and Alzheimer's diseases, by modulating the immune system.Formula:C14H19NO2Purity:Min. 95%Molecular weight:233.31 g/mol8-M-PDOT
CAS:8-M-PDOT (AH-002) is an MT2 receptor agonist that inhibits MT1.8-M-PDOT has anxiolytic activity and may be used in the study of neuropathic pain.Formula:C14H19NO2Purity:99.54% - 99.54%Color and Shape:SolidMolecular weight:233.31


