CAS 13487-41-7

6,9,12,15-Heneicosatetraenoic acid, methyl ester, (all-Z)-

Description:

6,9,12,15-Heneicosatetraenoic acid, methyl ester, commonly referred to as an all-Z fatty acid, is a long-chain polyunsaturated fatty acid characterized by its multiple double bonds in the Z configuration. This compound features a total of 21 carbon atoms and four double bonds, which contribute to its unique physical and chemical properties. The presence of these double bonds typically results in a lower melting point compared to saturated fatty acids, making it more fluid at room temperature. As a methyl ester, it is derived from the esterification of heneicosatetraenoic acid with methanol, which enhances its solubility in organic solvents. This compound is of interest in various fields, including biochemistry and nutrition, due to its potential roles in cellular functions and its implications in health. Additionally, its structure allows it to participate in various chemical reactions, making it a valuable compound for research and industrial applications. Overall, 6,9,12,15-Heneicosatetraenoic acid, methyl ester, is a significant fatty acid derivative with notable characteristics stemming from its polyunsaturated nature.

Formula: C₂₂H₃₆O₂

InChI: InChI=1S/C22H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-21H2,1-2H3/b8-7-,11-10-,14-13-,17-16-

InChI key: InChIKey=FYVTYELNLPIZCY-ZKWNWVNESA-N

SMILES: C(=C\C/C=C\C/C=C\C/C=C\CCCCC)\CCCCC(OC)=O

Synonyms:

• 6,9,12,15-Heneicosatetraenoic acid, methyl ester, (all-Z)-

Methyl 6(Z),9(Z),12(Z),15(Z)-Heneicosatetraenoate

CAS: 13487-41-7

Formula: C22H36O2

Purity: >98%

Color and Shape: In solution, Methanol

Molecular weight: 332.52

Ref: 48-20-2104