CAS 134877-43-3

β-D-erythro-Pentofuranose, 2-deoxy-2,2-difluoro-, 3,5-dibenzoate 1-methanesulfonate

Description:

β-D-erythro-Pentofuranose, 2-deoxy-2,2-difluoro-, 3,5-dibenzoate 1-methanesulfonate is a synthetic compound characterized by its unique structural features, including a pentofuranose sugar backbone modified with difluoro substituents and benzoate groups. The presence of the 2-deoxy modification indicates the absence of a hydroxyl group at the second carbon, which can influence its reactivity and biological activity. The methanesulfonate group serves as a leaving group, making the compound potentially useful in various chemical reactions, particularly in the synthesis of more complex molecules. This compound may exhibit interesting properties such as solubility in organic solvents and stability under certain conditions, which are typical for sugar derivatives. Its fluorinated nature may impart unique electronic properties, potentially enhancing its interaction with biological targets. Overall, this compound's structural complexity and functional groups suggest potential applications in medicinal chemistry and biochemistry, particularly in the development of nucleoside analogs or other therapeutic agents.

Formula: C₂₀H₁₈F₂O₈S

InChI: InChI=1S/C20H18F2O8S/c1-31(25,26)30-19-20(21,22)16(29-18(24)14-10-6-3-7-11-14)15(28-19)12-27-17(23)13-8-4-2-5-9-13/h2-11,15-16,19H,12H2,1H3/t15-,16-,19+/m1/s1

InChI key: InChIKey=LIAQHZDWFACWFK-MDZRGWNJSA-N

SMILES: O(C(=O)C1=CC=CC=C1)[C@@H]2[C@@H](COC(=O)C3=CC=CC=C3)O[C@@H](OS(C)(=O)=O)C2(F)F

Synonyms:

• 3,5-Bis(Benzoyl)-1-Methanesulfonyloxy-2-Deoxy-2,2-Difluororibose
• 3,5-Di-O-benzoyl-2-deoxy-2,2-difluoro-1-O- methanesulfonyl-D-ribofuranose
• β-<span class="text-smallcaps">D</span>-erythro-Pentofuranose, 2-deoxy-2,2-difluoro-, 3,5-dibenzoate 1-methanesulfonate
• β-D-erythro-Pentofuranose, 2-deoxy-2,2-difluoro-, 3,5-dibenzoate 1-methanesulfonate

3,5-Di-O-benzoyl-2-deoxy-2,2-difluoro-1-O-methanesulfonyl-D-ribofuranoside

CAS: 134877-43-3

Ref: 7W-GC0809