CAS 134887-87-9

5-(1-hydroxyethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid

Description:

5-(1-hydroxyethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid, with CAS number 134887-87-9, is a complex organic compound characterized by its multi-functional groups, including a pyridine ring and an imidazole moiety. This substance typically exhibits properties such as solubility in polar solvents, which is common for compounds containing hydroxyl and carboxylic acid groups. Its structure suggests potential biological activity, possibly acting as a pharmaceutical agent or a biochemical probe, due to the presence of the imidazole ring, which is often associated with enzyme inhibition or receptor binding. The compound may also display moderate to high melting and boiling points, indicative of its solid-state characteristics. Additionally, it may undergo various chemical reactions, including esterification and amidation, due to its reactive functional groups. Overall, this compound's unique structure and functional groups contribute to its potential applications in medicinal chemistry and related fields.

Formula: C₁₅H₁₉N₃O₄

InChI: InChI=1/C15H19N3O4/c1-7(2)15(4)14(22)17-12(18-15)11-10(13(20)21)5-9(6-16-11)8(3)19/h5-8,19H,1-4H3,(H,20,21)(H,17,18,22)

SMILES: CC(C)C1(C)C(=O)N=C(c2c(cc(cn2)C(C)O)C(=O)O)N1

Synonyms:

• 134887-87-9
• 3-pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(1-hydroxyethyl)-
• 5-(1-Hydroxyethyl)-2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid

Imazethapyr-1-hydroxyethyl

CAS: 134887-87-9

Formula: C₁₅H₁₉N₃O₄

Color and Shape: Neat

Molecular weight: 305.33

Ref: 04-C14283510

Imazethapyr-1-hydroxyethyl 100 µg/mL in Acetonitrile

CAS: 134887-87-9

Formula: C₁₅H₁₉N₃O₄

Color and Shape: Single Solution

Molecular weight: 305.33

Ref: 04-A14283510AL-100

5-(1-Hydroxyethyl) Imazapyr

Controlled Product

CAS: 134887-87-9

Formula: C₁₅H₁₉N₃O₄

Color and Shape: Neat

Molecular weight: 305.33

Ref: TR-H942370

Imazethapyr-1-hydroxyethyl

CAS: 134887-87-9

Imazethapyr-1-hydroxyethyl is a selective, systemic herbicide, which is synthesized through chemical processes. It functions primarily by inhibiting the acetohydroxyacid synthase (AHAS) enzyme, also known as acetolactate synthase (ALS). This enzyme is vital for the biosynthesis of branched-chain amino acids like valine, leucine, and isoleucine, which are essential for plant growth. By hindering this enzyme's action, Imazethapyr-1-hydroxyethyl effectively stunts the growth and development of susceptible plant species.

Formula: C₁₅H₁₉N₃O₄

Purity: Min. 95%

Molecular weight: 305.33 g/mol

Ref: 3D-JFA88787