CAS 134887-87-9: 5-(1-hydroxyethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid
Description:5-(1-hydroxyethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid, with CAS number 134887-87-9, is a complex organic compound characterized by its multi-functional groups, including a pyridine ring and an imidazole moiety. This substance typically exhibits properties such as solubility in polar solvents, which is common for compounds containing hydroxyl and carboxylic acid groups. Its structure suggests potential biological activity, possibly acting as a pharmaceutical agent or a biochemical probe, due to the presence of the imidazole ring, which is often associated with enzyme inhibition or receptor binding. The compound may also display moderate to high melting and boiling points, indicative of its solid-state characteristics. Additionally, it may undergo various chemical reactions, including esterification and amidation, due to its reactive functional groups. Overall, this compound's unique structure and functional groups contribute to its potential applications in medicinal chemistry and related fields.
Formula:C15H19N3O4
InChI:InChI=1/C15H19N3O4/c1-7(2)15(4)14(22)17-12(18-15)11-10(13(20)21)5-9(6-16-11)8(3)19/h5-8,19H,1-4H3,(H,20,21)(H,17,18,22)
- Synonyms:
- 134887-87-9
- 3-pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(1-hydroxyethyl)-
- 5-(1-Hydroxyethyl)-2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid
![5-(1-hydroxyethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carbo…](https://static.cymitquimica.com/cas-image/256874-5-1-hydroxyethyl-2-4-methyl-5-oxo-4-propan-2-yl-45-dihydro-1h-imidazol-2-yl-pyridine-3-carboxylic-acid.png)
