CAS 134888-93-0

3-carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide

Description:

3-Carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide, with the CAS number 134888-93-0, is a synthetic organic compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features multiple functional groups, including carboxylic acid and amide groups, contributing to its potential solubility in polar solvents and its reactivity in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially leading to applications in medicinal chemistry. Additionally, the isoxazole moiety is often associated with various pharmacological properties, including anti-inflammatory and analgesic effects. Overall, this compound's unique structural features and functional groups position it as a candidate for further investigation in drug development and related fields.

Formula: C₁₃H₉F₃N₂O₄

InChI: InChI=1/C13H9F3N2O4/c1-6-9(10(12(20)21)18-22-6)11(19)17-8-4-2-7(3-5-8)13(14,15)16/h2-5H,1H3,(H,17,19)(H,20,21)

SMILES: Cc1c(c(C(=O)O)no1)C(=O)Nc1ccc(cc1)C(F)(F)F

Synonyms:

• Cmtpi
• 3-Isoxazolecarboxylic acid, 5-methyl-4-(((4-(trifluoromethyl)phenyl)amino)carbonyl)-
• 5-Methyl-4-{[4-(Trifluoromethyl)Phenyl]Carbamoyl}-1,2-Oxazole-3-Carboxylic Acid
• 3-Carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide