
CAS 134888-97-4
:3-(1-Pyrrolidinyl)-N-[4-(trifluoromethyl)phenyl]-2-butenamide
Description:
3-(1-Pyrrolidinyl)-N-[4-(trifluoromethyl)phenyl]-2-butenamide, with the CAS number 134888-97-4, is a chemical compound characterized by its unique structural features, including a pyrrolidine ring and a trifluoromethyl-substituted phenyl group. This compound belongs to the class of amides and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. The pyrrolidine moiety may contribute to its ability to interact with biological targets, making it of interest in drug discovery. Additionally, the compound's double bond in the butenamide structure may impart reactivity, allowing for further chemical modifications. Overall, this compound's characteristics suggest it could be explored for various applications, including therapeutic uses, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C15H17F3N2O
InChI:InChI=1S/C15H17F3N2O/c1-11(20-8-2-3-9-20)10-14(21)19-13-6-4-12(5-7-13)15(16,17)18/h4-7,10H,2-3,8-9H2,1H3,(H,19,21)
InChI key:InChIKey=ZYYRRZKVIRYJOG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(NC(C=C(C)N2CCCC2)=O)C=C1
Synonyms:- 2-Butenamide, 3-(1-pyrrolidinyl)-N-[4-(trifluoromethyl)phenyl]-
- 3-(1-Pyrrolidinyl)-N-[4-(trifluoromethyl)phenyl]-2-butenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.