CAS 134892-26-5
:2'-fluoro-2',3'-dideoxyinosine
Description:
2'-Fluoro-2',3'-dideoxyinosine, commonly referred to as FddI, is a synthetic nucleoside analog that exhibits antiviral properties, particularly against retroviruses such as HIV. Its structure features a fluorine atom at the 2' position of the ribose sugar, which contributes to its stability and resistance to degradation by nucleoside enzymes. This modification enhances its ability to inhibit viral replication by interfering with the reverse transcription process. FddI is characterized by its low toxicity to host cells, making it a potential candidate for therapeutic applications. The compound is typically administered in a phosphorylated form, which is necessary for its incorporation into viral DNA. Additionally, FddI has been studied for its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which are crucial for determining its efficacy and safety profile in clinical settings. Overall, 2'-fluoro-2',3'-dideoxyinosine represents an important advancement in antiviral drug development, particularly in the context of HIV treatment strategies.
Formula:C10H11FN4O3
InChI:InChI=1/C10H11FN4O3/c11-6-1-5(2-16)18-10(6)15-4-14-7-8(15)12-3-13-9(7)17/h3-6,10,16H,1-2H2,(H,12,13,17)/t5-,6+,10+/m0/s1
Synonyms:- 2',3'-Dideoxy-2'-fluoroinosine
- Inosine, 2',3'-dideoxy-2'-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.