CAS 134892-32-3
:5,7-Dichloro-N-(2,6-dichloro-3-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide
Description:
5,7-Dichloro-N-(2,6-dichloro-3-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide, with CAS number 134892-32-3, is a synthetic organic compound characterized by its complex structure that includes a triazole and pyrimidine moiety. This compound features multiple chlorine substituents, which contribute to its chemical reactivity and potential biological activity. The sulfonamide functional group is known for its role in medicinal chemistry, particularly in the development of antimicrobial agents. The presence of the dichloro and methyl groups on the phenyl ring may influence the compound's lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, the triazole ring is often associated with various biological activities, including antifungal and anticancer properties. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, although specific biological activities and therapeutic uses would require further investigation through experimental studies.
Formula:C12H7Cl4N5O2S
InChI:InChI=1S/C12H7Cl4N5O2S/c1-5-2-3-6(13)10(9(5)16)20-24(22,23)12-18-11-17-7(14)4-8(15)21(11)19-12/h2-4,20H,1H3
InChI key:InChIKey=FWQYDFJTQRNKMD-UHFFFAOYSA-N
SMILES:ClC=1N2C(=NC(S(NC3=C(Cl)C(C)=CC=C3Cl)(=O)=O)=N2)N=C(Cl)C1
Synonyms:- 5,7-Dichloro-N-(2,6-Dichloro-3-Methylphenyl)-1,2,4-Triazolo[1,5-A]Pyrimidine-2-Sulfonamide
- [1,2,4]Triazolo[1,5-a]pyrimidine-2-sulfonamide, 5,7-dichloro-N-(2,6-dichloro-3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.