CymitQuimica logo

CAS 134892-47-0

:

N-(2-Aminoethyl)-N′-(5-bromo-6-quinoxalinyl)thiourea

Description:
N-(2-Aminoethyl)-N′-(5-bromo-6-quinoxalinyl)thiourea is a chemical compound characterized by its unique structure, which includes a thiourea moiety and a quinoxaline derivative. This compound typically exhibits properties associated with both thioureas and heterocyclic compounds, such as potential biological activity and the ability to form hydrogen bonds due to the presence of amino and thiourea functional groups. The bromine substituent on the quinoxaline ring can influence its reactivity and solubility, potentially enhancing its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its synthesis and characterization would involve standard organic chemistry techniques, and it may exhibit specific interactions with biological targets, making it a candidate for further research in the fields of biochemistry and pharmacology. As with many compounds containing heterocycles and functional groups, its behavior in various solvents and under different conditions would be crucial for understanding its applications.
Formula:C11H12BrN5S
InChI:InChI=1S/C11H12BrN5S/c12-9-7(17-11(18)16-4-3-13)1-2-8-10(9)15-6-5-14-8/h1-2,5-6H,3-4,13H2,(H2,16,17,18)
InChI key:InChIKey=PKKDYWFVHATGII-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC1NC(NCCN)=S)N=CC=N2
Synonyms:
  • Thiourea, N-(2-aminoethyl)-N′-(5-bromo-6-quinoxalinyl)-
  • N-(2-Aminoethyl)-N′-(5-bromo-6-quinoxalinyl)thiourea
  • 1-(2-Aminoethyl)-3-(5-bromoquinoxalin-6-yl)thiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.