
CAS 13490-36-3
:3-Methyldodecanoic acid
Description:
3-Methyldodecanoic acid, with the CAS number 13490-36-3, is a branched-chain fatty acid characterized by a 12-carbon backbone with a methyl group located at the third carbon position. This structure contributes to its unique physical and chemical properties compared to straight-chain fatty acids. It is typically a colorless to pale yellow liquid or solid at room temperature, depending on its purity and specific conditions. The compound is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 3-Methyldodecanoic acid exhibits typical fatty acid behavior, including the ability to form esters and amides, and can participate in various chemical reactions such as oxidation and reduction. It is of interest in various applications, including the synthesis of surfactants, lubricants, and as a potential intermediate in organic synthesis. Additionally, its branched structure may influence its melting point and boiling point, making it distinct from its linear counterparts.
Formula:C13H26O2
InChI:InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-12(2)11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15)
InChI key:InChIKey=KZNOWILOENIYSH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)(CC(O)=O)C
Synonyms:- 3-Methyldodecanoic acid
- Dodecanoic acid, 3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Methyldodecanoic acid
CAS:3-Methyldodecanoic acid is a carbamate compound that can be synthesized through the carboxylation of benzene followed by halogenation. It is a photosensitive compound and can be used as a synthetic method for various applications. 3-Methyldodecanoic acid undergoes lactonization to form a cyclic ester, making it suitable for use as a long-chain photopolymerizable fatty acid. This compound is commonly used in research chemicals and can act as a metal catalyst or a photopolymerization initiator. Its versatile properties make it an excellent choice for various industrial and scientific applications.
Formula:C13H26O2Purity:Min. 95%Molecular weight:214.34 g/mol
