CAS 134907-84-9
:FLUO 3
Description:
FLUO 3, with the CAS number 134907-84-9, is a chemical compound that is primarily recognized for its application in the field of fluorine chemistry. It is characterized by its unique properties, including high reactivity and stability under specific conditions. The compound typically exhibits a strong affinity for other elements, particularly in forming fluorinated derivatives. FLUO 3 is often utilized in various industrial processes, including the synthesis of fluorinated organic compounds and in the production of specialty chemicals. Its molecular structure may include multiple fluorine atoms, contributing to its distinctive chemical behavior, such as low volatility and high electronegativity. Safety considerations are paramount when handling FLUO 3, as it can be hazardous due to its reactivity and potential toxicity. Proper storage and handling protocols are essential to mitigate risks associated with exposure. Overall, FLUO 3 plays a significant role in advancing fluorine chemistry and its applications across different sectors.
Formula:C36H42Cl2N6O13
InChI:InChI=1/C36H30Cl2N2O13.4H3N/c1-18-6-20(39(14-32(43)44)15-33(45)46)9-21(7-18)51-4-5-52-31-8-19(2-3-26(31)40(16-34(47)48)17-35(49)50)36-22-10-24(37)27(41)12-29(22)53-30-13-28(42)25(38)11-23(30)36;;;;/h2-3,6-13,41H,4-5,14-17H2,1H3,(H,43,44)(H,45,46)(H,47,48)(H,49,50);4*1H3
SMILES:Cc1cc(cc(c1)OCCOc1cc(ccc1N(CC(=O)O)CC(=O)O)c1c2cc(c(cc2oc2cc(=O)c(cc12)Cl)O)Cl)N(CC(=O)O)CC(=O)O.N.N.N.N
Synonyms:- Fluo 3 Ammonium
- 1-[2-Amino-5-(2,7-Dichloro-6-Hydroxy-3-Oxy-9-Xanthenyl)Phenoxy]-2-(2-Amino-5-Methylphenoxy)Ethane-N,N,N',N'-Tetraacetic Acid Ammonium-Potassium Salt
- tetraammonium {[3-(2-{2-[bis(carboxylatomethyl)amino]-5-(2,7-dichloro-6-hydroxy-3-oxo-3H-xanthen-9-yl)phenoxy}ethoxy)-5-methylphenyl](carboxylatomethyl)amino}acetate (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FLUO 3, Pentaammonium Salt
CAS:Controlled ProductFormula:C35H28Cl2N2O13•x(NH3)Color and Shape:NeatMolecular weight:755.51 + x(17.03)
