CAS 134907-85-0
:tripalmitelaiden
Description:
Tripalmitelaiden, identified by the CAS number 134907-85-0, is a synthetic chemical compound that belongs to the class of phospholipids. It is characterized by its structure, which includes three palmitic acid chains esterified to a glycerol backbone, along with a nitrogen-containing head group. This compound is typically used in biochemical and pharmaceutical applications, particularly in the formulation of liposomes and drug delivery systems due to its amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments. Tripalmitelaiden exhibits stability in various conditions and can form bilayers, making it useful in mimicking biological membranes. Additionally, its biocompatibility and ability to encapsulate therapeutic agents enhance its potential in targeted drug delivery. The compound's properties, such as melting point, solubility, and reactivity, are influenced by its fatty acid composition and the presence of functional groups, which can affect its behavior in biological systems. Overall, tripalmitelaiden is a valuable compound in the field of medicinal chemistry and biophysics.
Formula:C51H92O6
InChI:InChI=1/C51H92O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h19-24,48H,4-18,25-47H2,1-3H3/b22-19+,23-20+,24-21+
Synonyms:- propane-1,2,3-triyl (9E,9'E,9''E)tris-hexadec-9-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glyceryl Tripalmitelaidate
CAS:Controlled ProductFormula:C51H92O6Color and Shape:NeatMolecular weight:801.27
