CAS 13491-13-9

(2R)-3-methyl-2-phenylbutanoic acid

Description:

(2R)-3-methyl-2-phenylbutanoic acid, also known as a chiral carboxylic acid, is characterized by its specific stereochemistry, which contributes to its unique properties and potential applications in pharmaceuticals and organic synthesis. This compound features a branched aliphatic chain with a phenyl group, imparting both hydrophobic and hydrophilic characteristics. The presence of the carboxylic acid functional group (-COOH) allows for hydrogen bonding, influencing its solubility in polar solvents, while the bulky methyl and phenyl substituents can affect its reactivity and interaction with biological systems. The chirality of the molecule can lead to different biological activities depending on the enantiomer, making it significant in the development of chiral drugs. Additionally, its molecular structure suggests potential applications in asymmetric synthesis and as a building block in organic chemistry. Overall, (2R)-3-methyl-2-phenylbutanoic acid exemplifies the importance of stereochemistry in determining the properties and applications of organic compounds.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)/t10-/m1/s1

SMILES: CC(C)[C@H](c1ccccc1)C(=O)O

Synonyms:

• benzeneacetic acid, α-(1-methylethyl)-, (alphaR)-(R)-2-Phenyl-3-Methylbutanoic Acid
• (2R)-3-Methyl-2-phenylbutanoic acid

(R)-2-Phenyl-3-methylbutanoic acid

CAS: 13491-13-9

Formula: C₁₁H₁₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.2277

Ref: IN-DA009FZE

(R)-3-Methyl-2-phenylbutanoic acid

CAS: 13491-13-9

(R)-3-Methyl-2-phenylbutanoic acid

Purity: 98%

Molecular weight: 178.23g/mol

Ref: 54-OR92868

(R)-3-Methyl-2-phenylbutanoic acid

CAS: 13491-13-9

Formula: C₁₁H₁₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.231

Ref: 10-F209779