CAS 1349199-53-6

1-(2-Furanyl)-6-[(4-methylphenyl)sulfonyl]-2-oxa-6-azaspiro[3.3]heptane

Description:

1-(2-Furanyl)-6-[(4-methylphenyl)sulfonyl]-2-oxa-6-azaspiro[3.3]heptane is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a furan ring and a sulfonyl group. The presence of the furan moiety contributes to its potential reactivity and interaction with biological systems, while the sulfonyl group may enhance its solubility and stability. This compound features a nitrogen atom within its spirocyclic framework, indicating potential for various interactions, including hydrogen bonding. The overall structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, the compound's molecular configuration may influence its physical properties, such as melting point, boiling point, and solubility in different solvents. As with many organic compounds, its behavior in biological systems would depend on factors like lipophilicity and metabolic stability. Overall, this compound represents a complex and potentially bioactive structure worthy of investigation in the context of drug development and chemical synthesis.

Formula: C₁₆H₁₇NO₄S

InChI: InChI=1S/C16H17NO4S/c1-12-4-6-13(7-5-12)22(18,19)17-9-16(10-17)11-21-15(16)14-3-2-8-20-14/h2-8,15H,9-11H2,1H3

InChI key: InChIKey=SODQXNZRQBTVCD-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CC2(C(OC2)C3=CC=CO3)C1)C4=CC=C(C)C=C4

Synonyms:

• 2-Oxa-6-azaspiro[3.3]heptane, 1-(2-furanyl)-6-[(4-methylphenyl)sulfonyl]-
• 1-(2-Furanyl)-6-[(4-methylphenyl)sulfonyl]-2-oxa-6-azaspiro[3.3]heptane
• 1-(Furan-2-yl)-6-tosyl-2-oxa-6-azaspiro[3.3]heptane