CAS 134924-68-8
:2-[(4-hydroxycyclohexyl)carbonyl]-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one
Description:
The chemical substance known as 2-[(4-hydroxycyclohexyl)carbonyl]-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one, with the CAS number 134924-68-8, is a complex organic compound characterized by its unique structural features. It contains a pyrazinoisoquinoline core, which is a bicyclic structure that contributes to its potential biological activity. The presence of a cyclohexyl group with a hydroxyl substituent indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological targets. The carbonyl group attached to the cyclohexyl moiety suggests potential reactivity and the ability to participate in various chemical reactions. This compound may be of interest in medicinal chemistry due to its structural motifs that are often associated with pharmacological properties. Additionally, its stereochemistry and functional groups could play significant roles in determining its biological activity, making it a candidate for further research in drug development and therapeutic applications.
Formula:C19H24N2O3
InChI:InChI=1/C19H24N2O3/c22-15-7-5-14(6-8-15)19(24)20-11-17-16-4-2-1-3-13(16)9-10-21(17)18(23)12-20/h1-4,14-15,17,22H,5-12H2
SMILES:c1ccc2c(c1)CCN1C2CN(CC1=O)C(=O)C1CCC(CC1)O
Synonyms:- 4H-Pyrazino(2,1-a)isoquinolin-4-one, 1,2,3,6,7,11b-hexahydro-2-((4-hydroxycyclohexyl)carbonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
cis-Hydroxy Praziquantel
CAS:Applications The main cis-monohydroxylated metabolite of Praziquantel (P702095).
References Buehring, K., et al.: Eur. J. Drug Metab. Pharm., 3, 179 (1978), Moldeus, P., et al.: Methods Enzymol., 52, 60 (1978), Cioli, D., et al.: Pharmacol. Ther., 68, 35 (1995),Formula:C19H24N2O3Color and Shape:NeatMolecular weight:328.4
