CAS 134926-95-7

Ethanone, 1-[1-(1-methylethyl)-1H-1,2,3-triazol-4-yl]-

Description:

Ethanone, 1-[1-(1-methylethyl)-1H-1,2,3-triazol-4-yl]- is a chemical compound characterized by its unique structure, which includes a triazole ring and an ethanone moiety. The presence of the triazole ring imparts notable stability and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound features a branched alkyl group, specifically isopropyl, which can influence its solubility and reactivity. Generally, compounds with triazole functionalities are known for their ability to form hydrogen bonds, which can enhance their interactions with biological targets. This substance may exhibit properties such as antimicrobial or antifungal activity, typical of many triazole derivatives. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the design of new therapeutic agents. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-5(2)10-4-7(6(3)11)8-9-10/h4-5H,1-3H3

InChI key: InChIKey=WQBUQCVXDZQIOV-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CN(C(C)C)N=N1

Synonyms:

• 1-[1-(Propan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-one
• 1H-1,2,3-Triazole, ethanone deriv.
• Ethanone, 1-[1-(1-methylethyl)-1H-1,2,3-triazol-4-yl]-
• 1-(1-Isopropyl-1H-1,2,3-triazol-4-yl)ethanone

1-[1-(Propan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-one

CAS: 134926-95-7

Versatile small molecule scaffold

Formula: C₇H₁₁N₃O

Purity: Min. 95%

Molecular weight: 153.18 g/mol

Ref: 3D-JFA92695