CAS 13493-47-5
:N-(2-formylphenyl)acetamide
Description:
N-(2-formylphenyl)acetamide, also known by its CAS number 13493-47-5, is an organic compound characterized by its amide functional group and an aromatic ring. This compound features a phenyl group substituted with a formyl group (–CHO) at the ortho position relative to the acetamide group (–C(=O)NH2). It typically appears as a solid at room temperature and is soluble in polar organic solvents due to the presence of both hydrophilic and hydrophobic regions in its structure. The compound may exhibit various chemical properties, including reactivity towards nucleophiles and electrophiles, making it useful in organic synthesis and medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or as intermediates in chemical reactions. Additionally, the presence of the formyl group may impart specific reactivity patterns, such as undergoing condensation reactions or participating in aromatic substitution. Overall, N-(2-formylphenyl)acetamide is a compound of interest in both academic and industrial chemistry contexts.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c1-7(12)10-9-5-3-2-4-8(9)6-11/h2-6H,1H3,(H,10,12)
SMILES:CC(=Nc1ccccc1C=O)O
Synonyms:- Acetamide, N-(2-formylphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Acetamidobenzaldehyde
CAS:Formula:C9H9NO2Purity:>98.0%(GC)Color and Shape:White to Yellow powder to crystalMolecular weight:163.18N-(2-Formylphenyl)acetamide
CAS:Formula:C9H9NO2Purity:98%Color and Shape:SolidMolecular weight:163.1733N -(2-Formyl-phenyl)-acetamide
CAS:Formula:C9H9NO2Purity:98%Color and Shape:SolidMolecular weight:163.176N-(2-Formylphenyl)acetamide
CAS:N-(2-Formylphenyl)acetamide is an acrylonitrile derivative that has been shown to inhibit viruses in vitro. It also inhibits the synthesis of the enzyme preparations in human liver cells. In humans, N-(2-Formylphenyl)acetamide is used for the treatment of hepatitis B and C. It is also effective against autoimmune diseases such as rheumatoid arthritis and psoriasis. N-(2-Formylphenyl)acetamide has a molecular weight of 276.3 g/mol and a melting point of 118 °C. It is an amide with a structure that consists of two amino groups attached to an aromatic ring (benzene). This compound can be synthesized from hydrochloric acid and an amide, which are both easily accessible chemical compounds. This drug binds to collagen and inhibits its production, which may play a role in its inhibition of cancer cells by preventing new blood vessels from forming.Formula:C9H9NO2Purity:Min. 95%Molecular weight:163.17 g/mol




