CymitQuimica logo

CAS 13493-79-3

:

6-Chloroimidazo[1,2-b]pyridazine, HCl

Description:
6-Chloroimidazo[1,2-b]pyridazine, HCl, is a heterocyclic compound characterized by its imidazo and pyridazine ring structures, which contribute to its unique chemical properties. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the hydrochloride salt form. The chlorine substituent at the 6-position of the imidazo ring enhances its reactivity and potential biological activity. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or anticancer activities. The presence of the hydrochloride group suggests that it can act as a proton donor, influencing its behavior in various chemical reactions and biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 6-Chloroimidazo[1,2-b]pyridazine, HCl, represents a significant class of compounds in drug development and chemical research.
Formula:C6H5Cl2N3
InChI:InChI=1/C6H4ClN3.ClH/c7-5-1-2-6-8-3-4-10(6)9-5;/h1-4H;1H
InChI key:BSHQWSFYUQCQMB-UHFFFAOYSA-N
SMILES:c1cc2nccn2nc1Cl.Cl
Synonyms:
  • 6-Chloro-Imidazo[1,2-B]Pyridazine, Monohydrochloride
  • 6-Chloroimidazo[2,1-F]Pyridazine Hydrochloride
  • 6-Chloroimidazo[1,2-B]Pyridazine Hydrochloride
Found 4 products.