CAS 134937-34-1

1-(PHENYLSULFONYL)CYCLOPENTANECARBOXYLIC ACID

Description:

1-(Phenylsulfonyl)cyclopentanecarboxylic acid is an organic compound characterized by its cyclopentane structure substituted with a phenylsulfonyl group and a carboxylic acid functional group. This compound typically exhibits properties common to carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the phenylsulfonyl group enhances its reactivity and may contribute to its potential as a reagent or intermediate in organic synthesis. The sulfonyl group can also impart unique electronic properties, making the compound useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 1-(phenylsulfonyl)cyclopentanecarboxylic acid is a versatile compound with significant implications in organic synthesis and medicinal chemistry.

Formula: C₁₂H₁₄O₄S

InChI: InChI=1/C12H14O4S/c13-11(14)12(8-4-5-9-12)17(15,16)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,13,14)

SMILES: c1ccc(cc1)S(=O)(=O)C1(CCCC1)C(=O)O

Synonyms:

• Cyclopentanecarboxylic acid, 1-(phenylsulfonyl)-
• 1-(benzenesulfonyl)cyclopentane-1-carboxylic acid

1-(Benzenesulfonyl)cyclopentane-1-carboxylic acid

CAS: 134937-34-1

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₄S

Purity: Min. 95%

Molecular weight: 254.3 g/mol

Ref: 3D-JFA93734