CAS 134947-25-4

1-Benzoyl-3,5-bis(trifluoromethyl)pyrazole

Description:

1-Benzoyl-3,5-bis(trifluoromethyl)pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the benzoyl group contributes to its aromatic character, while the two trifluoromethyl groups (-CF3) significantly enhance its lipophilicity and influence its electronic properties. This compound is typically a solid at room temperature and exhibits stability under standard conditions. Its unique structure imparts notable chemical reactivity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The trifluoromethyl groups can enhance biological activity and alter the compound's interaction with biological targets. Additionally, the compound may exhibit interesting spectroscopic properties, making it suitable for analytical studies. Overall, 1-benzoyl-3,5-bis(trifluoromethyl)pyrazole is a versatile compound with potential applications in synthetic chemistry and material science.

Formula: C₁₂H₆F₆N₂O

InChI: InChI=1/C12H6F6N2O/c13-11(14,15)8-6-9(12(16,17)18)20(19-8)10(21)7-4-2-1-3-5-7/h1-6H

SMILES: c1ccc(cc1)C(=O)n1c(cc(C(F)(F)F)n1)C(F)(F)F

Synonyms:

• 1-(phenylcarbonyl)-3,5-bis(trifluoromethyl)-1H-pyrazole

[3,5-Bis(Trifluoromethyl)-1H-Pyrazol-1-Yl]Phenyl-Methanone

Controlled Product

CAS: 134947-25-4

Please enquire for more information about [3,5-Bis(Trifluoromethyl)-1H-Pyrazol-1-Yl]Phenyl-Methanone including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₆F₆N₂O

Purity: Min. 95%

Molecular weight: 308.18 g/mol

Ref: 3D-FB95596