CAS 134948-69-9
:4-oxo-4-(2,3,5,6-tetramethylphenyl)butanoic acid
Description:
4-Oxo-4-(2,3,5,6-tetramethylphenyl)butanoic acid, with the CAS number 134948-69-9, is an organic compound characterized by its unique structure, which includes a butanoic acid moiety and a ketone functional group. This compound features a bulky tetramethyl-substituted phenyl group, contributing to its steric hindrance and potentially influencing its reactivity and solubility. The presence of both a carboxylic acid and a ketone functional group suggests that it may participate in various chemical reactions, such as esterification or condensation. Its molecular structure may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Additionally, the compound's unique substituents may affect its biological activity, making it of interest in pharmaceutical and materials science research. Overall, 4-oxo-4-(2,3,5,6-tetramethylphenyl)butanoic acid exemplifies the complexity and diversity of organic compounds in terms of structure and potential applications.
Formula:C14H18O3
InChI:InChI=1/C14H18O3/c1-8-7-9(2)11(4)14(10(8)3)12(15)5-6-13(16)17/h7H,5-6H2,1-4H3,(H,16,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.