
CAS 134955-48-9
:(5S)-3-[(2R)-2-Hydroxy-7-[(2S,5S)-tetrahydro-5-[(1S,4S,5S)-1,4,5-trihydroxynonadecyl]-2-furanyl]heptyl]-5-methyl-2(5H)-furanone
Description:
The chemical substance with the name "(5S)-3-[(2R)-2-Hydroxy-7-[(2S,5S)-tetrahydro-5-[(1S,4S,5S)-1,4,5-trihydroxynonadecyl]-2-furanyl]heptyl]-5-methyl-2(5H)-furanone" and CAS number "134955-48-9" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a furanone ring, which is a five-membered lactone containing a furan moiety, contributing to its potential biological activity. The presence of multiple hydroxyl (-OH) groups indicates that it may exhibit significant polarity and potential for hydrogen bonding, which can influence its solubility and reactivity. The stereochemical descriptors (5S, 2R, 2S, 5S, 1S, 4S) suggest that the compound has several chiral centers, which can affect its pharmacological properties and interactions with biological systems. This compound may be of interest in medicinal chemistry and natural product synthesis due to its structural complexity and potential bioactivity. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C35H64O7
InChI:InChI=1S/C35H64O7/c1-3-4-5-6-7-8-9-10-11-12-13-17-20-31(37)32(38)22-23-33(39)34-24-21-30(42-34)19-16-14-15-18-29(36)26-28-25-27(2)41-35(28)40/h25,27,29-34,36-39H,3-24,26H2,1-2H3/t27-,29+,30-,31-,32-,33-,34-/m0/s1
InChI key:InChIKey=VFRBLIGIRLWBKM-DILKLTJASA-N
SMILES:[C@@H](CC[C@@H]([C@H](CCCCCCCCCCCCCC)O)O)(O)[C@]1(O[C@@H](CCCCC[C@H](CC=2C(=O)O[C@@H](C)C2)O)CC1)[H]
Synonyms:- 2(5H)-Furanone, 3-[2-hydroxy-7-[tetrahydro-5-(1,4,5-trihydroxynonadecyl)-2-furanyl]heptyl]-5-methyl-, [2S-[2α[S*(R*)],5α(1R*,4R*,5R*)]]-
- (5S)-3-[(2R)-2-Hydroxy-7-[(2S,5S)-tetrahydro-5-[(1S,4S,5S)-1,4,5-trihydroxynonadecyl]-2-furanyl]heptyl]-5-methyl-2(5H)-furanone
- Gigantetrocin
- 2(5H)-Furanone, 3-[(2R)-2-hydroxy-7-[(2S,5S)-tetrahydro-5-[(1S,4S,5S)-1,4,5-trihydroxynonadecyl]-2-furanyl]heptyl]-5-methyl-, (5S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gigantetrocin
CAS:Gigantetrocin is a bioactive acetyl coenzyme derived from Goniothalamus giganteus, a plant in the Annonaceae family.Formula:C35H64O7Color and Shape:SolidMolecular weight:596.878
