CAS 134963-06-7

2-Fluoro-5-methyl-1,8-naphthyridine

Description:

2-Fluoro-5-methyl-1,8-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a fluorine atom at the 2-position and a methyl group at the 5-position contributes to its unique chemical properties. This compound is typically a pale yellow to light brown solid and is soluble in organic solvents. It exhibits basicity due to the nitrogen atoms in the ring, which can participate in protonation reactions. 2-Fluoro-5-methyl-1,8-naphthyridine is of interest in medicinal chemistry and drug development, as it may exhibit biological activity against various targets. Its reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which can affect the compound's interaction with biological molecules. Additionally, the compound's structure allows for potential modifications that can enhance its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₇FN₂

InChI: InChI=1S/C9H7FN2/c1-6-4-5-11-9-7(6)2-3-8(10)12-9/h2-5H,1H3

InChI key: InChIKey=DKJHKGIYFUGQNU-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C(F)C=C2)N=CC1

Synonyms:

• 1,8-Naphthyridine, 2-fluoro-5-methyl-
• 2-Fluoro-5-methyl-1,8-naphthyridine