CAS 1349699-62-2

1,1-Dimethylethyl (3R)-3-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3R)-3-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate, with CAS number 1349699-62-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups. The presence of a dimethyl group contributes to its steric hindrance, influencing its reactivity and interaction with biological systems. The methylamino and carbonyl functionalities suggest potential for hydrogen bonding and interactions with other molecules, making it of interest in medicinal chemistry. This compound may exhibit properties typical of piperidine derivatives, such as potential analgesic or psychoactive effects, depending on its specific interactions with biological targets. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, understanding its characteristics requires consideration of its molecular geometry, electronic structure, and potential for forming various derivatives or complexes. Further studies would be necessary to elucidate its specific applications and biological activity.

Formula: C₁₂H₂₃N₃O₃

InChI: InChI=1S/C12H23N3O3/c1-12(2,3)18-11(17)15-7-5-6-9(8-15)14-10(16)13-4/h9H,5-8H2,1-4H3,(H2,13,14,16)/t9-/m1/s1

InChI key: InChIKey=KYUNTJOORHDUFT-SECBINFHSA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](NC(NC)=O)CCC1

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[[(methylamino)carbonyl]amino]-, 1,1-dimethylethyl ester, (3R)-
• 1,1-Dimethylethyl (3R)-3-[[(methylamino)carbonyl]amino]-1-piperidinecarboxylate

(R)-tert-Butyl 3-[(methylcarbamoyl)amino]piperidine-1-carboxylate

CAS: 1349699-62-2

Formula: C₁₂H₂₃N₃O₃

Molecular weight: 257.334

Ref: 10-F069464