CAS 1349699-73-5

1,1-Dimethylethyl (3R)-3-[(1-oxopropyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3R)-3-[(1-oxopropyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1349699-73-5, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group at the 1-position of the piperidine, contributing to its steric bulk and potentially influencing its biological activity. The carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and amidation. The presence of an oxopropylamino substituent suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in biological systems. Its stereochemistry, denoted by the (3R) configuration, implies specific spatial arrangements that can significantly affect its interaction with biological targets. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.

Formula: C₁₃H₂₄N₂O₃

InChI: InChI=1S/C13H24N2O3/c1-5-11(16)14-10-7-6-8-15(9-10)12(17)18-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,16)/t10-/m1/s1

InChI key: InChIKey=LUDHQJVAKIUFLX-SNVBAGLBSA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](NC(CC)=O)CCC1

Synonyms:

• 1,1-Dimethylethyl (3R)-3-[(1-oxopropyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(1-oxopropyl)amino]-, 1,1-dimethylethyl ester, (3R)-

(R)-tert-Butyl 3-propionamidopiperidine-1-carboxylate

CAS: 1349699-73-5

Formula: C₁₃H₂₄N₂O₃

Molecular weight: 256.346

Ref: 10-F069752